Information card for entry 2216571
| Chemical name |
3,4-Dibutoxy-<i>N</i>^2^,<i>N</i>^2'^-bis(propan-2-ylidene)thiophene-2,5- dicarbohydrazide |
| Formula |
C20 H32 N4 O4 S |
| Calculated formula |
C20 H32 N4 O4 S |
| SMILES |
CCCCOc1c(sc(c1OCCCC)C(=O)NN=C(C)C)C(=O)NN=C(C)C |
| Title of publication |
3,4-Dibutoxy-<i>N</i>^2^,<i>N</i>^2'^-bis(propan-2-ylidene)thiophene-2,5-dicarbohydrazide |
| Authors of publication |
Li, Hai-Lin; Kang, Si-Shun; Zeng, Hai-Su; Wang, Hai-Bo |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
12 |
| Pages of publication |
o4762 - o4762 |
| a |
20.891 ± 0.004 Å |
| b |
10.526 ± 0.002 Å |
| c |
13.581 ± 0.003 Å |
| α |
90° |
| β |
128.24 ± 0.03° |
| γ |
90° |
| Cell volume |
2345.6 ± 1.3 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0942 |
| Residual factor for significantly intense reflections |
0.0612 |
| Weighted residual factors for significantly intense reflections |
0.161 |
| Weighted residual factors for all reflections included in the refinement |
0.1887 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.016 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2216571.html