Information card for entry 2216592
| Chemical name |
N-{2-Chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-1,2,3,6- tetrahydropyrimidinyl]phenyl}-2,2-bis(3-fluorophenoxy)acetamide |
| Formula |
C26 H17 Cl F5 N3 O5 |
| Calculated formula |
C26 H17 Cl F5 N3 O5 |
| SMILES |
Fc1cccc(c1)OC(C(=O)Nc1cc(ccc1Cl)N1C(=O)C=C(N(C1=O)C)C(F)(F)F)Oc1cccc(c1)F |
| Title of publication |
<i>N</i>-{2-Chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-1,2,3,6-tetrahydropyrimidinyl]phenyl}-2,2-bis(3-fluorophenoxy)acetamide |
| Authors of publication |
Zhi-Gao Tian |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
12 |
| Pages of publication |
o4596 - o4596 |
| a |
16.228 ± 0.0013 Å |
| b |
6.7102 ± 0.0006 Å |
| c |
23.772 ± 0.002 Å |
| α |
90° |
| β |
100.588 ± 0.001° |
| γ |
90° |
| Cell volume |
2544.5 ± 0.4 Å3 |
| Cell temperature |
299 ± 2 K |
| Ambient diffraction temperature |
299 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0673 |
| Residual factor for significantly intense reflections |
0.0537 |
| Weighted residual factors for significantly intense reflections |
0.1498 |
| Weighted residual factors for all reflections included in the refinement |
0.163 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.032 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2216592.html