Information card for entry 2216625
| Chemical name |
2-Methyl-2H-1,2-benzothiazin-4(3H)-one 1,1-dioxide |
| Formula |
C9 H9 N O3 S |
| Calculated formula |
C9 H9 N O3 S |
| SMILES |
S1(=O)(=O)N(CC(=O)c2c1cccc2)C |
| Title of publication |
2-Methyl-2<i>H</i>-1,2-benzothiazin-4(3<i>H</i>)-one 1,1-dioxide |
| Authors of publication |
Siddiqui, Waseeq Ahmad; Ahmad, Saeed; Siddiqui, Hamid Latif; Tariq, Muhammad Ilyas; Parvez, Masood |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
12 |
| Pages of publication |
o4585 - o4585 |
| a |
6.778 ± 0.005 Å |
| b |
8.634 ± 0.006 Å |
| c |
15.704 ± 0.01 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
919 ± 1.1 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0724 |
| Residual factor for significantly intense reflections |
0.0511 |
| Weighted residual factors for significantly intense reflections |
0.1133 |
| Weighted residual factors for all reflections included in the refinement |
0.1245 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.088 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2216625.html