Information card for entry 2217493
| Chemical name |
(4a<i>R</i>,8a<i>R</i>)-2,3-Diphenyl-4a,5,6,7,8,8a-hexahydroquinoxaline |
| Formula |
C20 H20 N2 |
| Calculated formula |
C20 H20 N2 |
| SMILES |
[C@@H]12CCCC[C@H]1N=C(c1ccccc1)C(=N2)c1ccccc1 |
| Title of publication |
(4a<i>R</i>,8a<i>R</i>)-2,3-Diphenyl-4a,5,6,7,8,8a-hexahydroquinoxaline |
| Authors of publication |
Wang, Guo-Xi; Ye, Heng-Yun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
2 |
| Pages of publication |
o359 - o359 |
| a |
5.6253 ± 0.0011 Å |
| b |
15.402 ± 0.003 Å |
| c |
18.315 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1586.8 ± 0.6 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0665 |
| Residual factor for significantly intense reflections |
0.0562 |
| Weighted residual factors for significantly intense reflections |
0.1269 |
| Weighted residual factors for all reflections included in the refinement |
0.1324 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.19 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217493.html