Information card for entry 2217510
| Chemical name |
4,4-Bis(4-methylphenylsulfanyl)-1,1-diphenyl-2-azabuta-1,3-diene |
| Formula |
C29 H25 N S2 |
| Calculated formula |
C29 H25 N S2 |
| SMILES |
S(C(=CN=C(c1ccccc1)c1ccccc1)Sc1ccc(cc1)C)c1ccc(cc1)C |
| Title of publication |
4,4-Bis(4-methylphenylsulfanyl)-1,1-diphenyl-2-azabuta-1,3-diene |
| Authors of publication |
Kinghat, Rodolphe; Boudiba, Hamid; Khatyr, Abderrahim; Knorr, Michael; Kubicki, Marek M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
2 |
| Pages of publication |
o370 - o370 |
| a |
6.934 ± 0.001 Å |
| b |
12.3009 ± 0.0002 Å |
| c |
14.4247 ± 0.0003 Å |
| α |
101.737 ± 0.0008° |
| β |
98.2522 ± 0.0007° |
| γ |
93.04 ± 0.001° |
| Cell volume |
1187.85 ± 0.17 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0402 |
| Residual factor for significantly intense reflections |
0.034 |
| Weighted residual factors for significantly intense reflections |
0.0854 |
| Weighted residual factors for all reflections included in the refinement |
0.0892 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217510.html