Information card for entry 2217587
| Common name |
Norbornane-<i>exo</i>-<i>cis</i>-2,3-diyl 1',2'-phenylene orthocarbonate |
| Chemical name |
4,7-methano-2,2'-spirobi[1,3-benzodioxole] |
| Formula |
C14 H14 O4 |
| Calculated formula |
C14 H14 O4 |
| SMILES |
O1C2(O[C@@H]3[C@H]1[C@H]1CC[C@@H]3C1)Oc1c(O2)cccc1 |
| Title of publication |
Norbornane-<i>exo</i>-<i>cis</i>-2,3-diyl 1',2'-phenylene orthocarbonate |
| Authors of publication |
Betz, Richard; Klüfers, Peter |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
2 |
| Pages of publication |
o399 - o399 |
| a |
7.9125 ± 0.0003 Å |
| b |
9.5545 ± 0.0005 Å |
| c |
15.2813 ± 0.0006 Å |
| α |
90° |
| β |
101.49 ± 0.003° |
| γ |
90° |
| Cell volume |
1132.11 ± 0.09 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0788 |
| Residual factor for significantly intense reflections |
0.0444 |
| Weighted residual factors for significantly intense reflections |
0.1038 |
| Weighted residual factors for all reflections included in the refinement |
0.1189 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.049 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217587.html