Information card for entry 2217699
| Chemical name |
2,2'-[1-(2,4,6-Trichlorophenyl)-1H-1,2,4-triazole-3,5-diyl]diphenol |
| Formula |
C20 H12 Cl3 N3 O2 |
| Calculated formula |
C20 H12 Cl3 N3 O2 |
| SMILES |
Clc1c(n2nc(nc2c2c(cccc2)O)c2c(cccc2)O)c(Cl)cc(Cl)c1 |
| Title of publication |
2,2'-[1-(2,4,6-Trichlorophenyl)-1<i>H</i>-1,2,4-triazole-3,5-diyl]diphenol |
| Authors of publication |
Li, Zhong-Shu; Li, Xiu-Bing; Sun, Bai-Wang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
2 |
| Pages of publication |
o491 - o491 |
| a |
14.328 ± 0.003 Å |
| b |
12.021 ± 0.002 Å |
| c |
12.014 ± 0.002 Å |
| α |
90° |
| β |
104.99 ± 0.03° |
| γ |
90° |
| Cell volume |
1998.8 ± 0.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0507 |
| Residual factor for significantly intense reflections |
0.0436 |
| Weighted residual factors for significantly intense reflections |
0.1008 |
| Weighted residual factors for all reflections included in the refinement |
0.1044 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.109 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217699.html