Information card for entry 2217722
| Chemical name |
<i>N</i>-(3,4-Difluorophenyl)-2-(3,4-dimethoxyphenyl)acetamide |
| Formula |
C16 H15 F2 N O3 |
| Calculated formula |
C16 H15 F2 N O3 |
| SMILES |
c1(cc(c(cc1)F)F)NC(=O)Cc1cc(c(cc1)OC)OC |
| Title of publication |
<i>N</i>-(3,4-Difluorophenyl)-2-(3,4-dimethoxyphenyl)acetamide |
| Authors of publication |
Hong, Won Ki; Lee, You-Soon; Han, Byung Hee; Kang, Sung Kwon; Sung, Chang Keun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
3 |
| Pages of publication |
o564 |
| a |
8.644 ± 0.0011 Å |
| b |
18.867 ± 0.006 Å |
| c |
9.4827 ± 0.0013 Å |
| α |
90° |
| β |
111.019 ± 0.011° |
| γ |
90° |
| Cell volume |
1443.6 ± 0.5 Å3 |
| Cell temperature |
295 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.0763 |
| Weighted residual factors for all reflections included in the refinement |
0.161 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.995 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217722.html