Information card for entry 2218285
| Chemical name |
(<i>S</i>)-Ethyl 1,2,3,9-tetrahydropyrrolo[2,1-b]quinazoline-1-carboxylate |
| Formula |
C14 H16 N2 O2 |
| Calculated formula |
C14 H16 N2 O2 |
| SMILES |
C1c2ccccc2N=C2CC[C@@H](C(=O)OCC)N12 |
| Title of publication |
(<i>S</i>)-Ethyl 1,2,3,9-tetrahydropyrrolo[2,1-<i>b</i>]quinazoline-1-carboxylate |
| Authors of publication |
Ma, Chao; Du, Gui-Jie; Tian, Yu; Sha, Yu; Cheng, Mao-Sheng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
5 |
| Pages of publication |
o815 |
| a |
6.0545 ± 0.0008 Å |
| b |
9.1438 ± 0.0013 Å |
| c |
11.5228 ± 0.0016 Å |
| α |
90° |
| β |
92.905 ± 0.002° |
| γ |
90° |
| Cell volume |
637.1 ± 0.15 Å3 |
| Cell temperature |
187 ± 2 K |
| Ambient diffraction temperature |
187 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0338 |
| Residual factor for significantly intense reflections |
0.0312 |
| Weighted residual factors for significantly intense reflections |
0.0741 |
| Weighted residual factors for all reflections included in the refinement |
0.0756 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.084 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218285.html