Information card for entry 2218315
| Chemical name |
5bα,6,7,13bα,14,15-Hexahydroacridino[4,3-<i>c</i>]acridine |
| Formula |
C24 H20 N2 |
| Calculated formula |
C24 H20 N2 |
| SMILES |
c1ccc2c(c1)nc1c(c2)CC[C@@H]2[C@H]1CCc1c2nc2c(c1)cccc2 |
| Title of publication |
5bα,6,7,13bα,14,15-Hexahydroacridino[4,3-<i>c</i>]acridine |
| Authors of publication |
Ashmore, Jason; Bishop, Roger; Craig, Donald C.; Scudder, Marcia L. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
6 |
| Pages of publication |
o1136 |
| a |
8.863 ± 0.003 Å |
| b |
9.759 ± 0.004 Å |
| c |
20.071 ± 0.008 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1736 ± 1.2 Å3 |
| Cell temperature |
294 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for significantly intense reflections |
0.048 |
| Weighted residual factors for all reflections included in the refinement |
0.059 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.64 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218315.html