Information card for entry 2218373
| Chemical name |
3,9-Dibromo-6,7-dihydro-5H-dibenzo[c,e]thiepine |
| Formula |
C14 H10 Br2 S |
| Calculated formula |
C14 H10 Br2 S |
| SMILES |
Brc1cc2c(cc1)c1c(cc(Br)cc1)CSC2 |
| Title of publication |
3,9-Dibromo-6,7-dihydro-5<i>H</i>-dibenzo[<i>c</i>,<i>e</i>]thiepine |
| Authors of publication |
Zhang, Hai-Quan; Bao-Li; Yang, Guang-Di; Ma, Yu-Guang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
6 |
| Pages of publication |
o1027 |
| a |
8.6629 ± 0.0012 Å |
| b |
4.7219 ± 0.0005 Å |
| c |
30.867 ± 0.003 Å |
| α |
90° |
| β |
93.72 ± 0.005° |
| γ |
90° |
| Cell volume |
1260 ± 0.3 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0762 |
| Residual factor for significantly intense reflections |
0.0381 |
| Weighted residual factors for significantly intense reflections |
0.0709 |
| Weighted residual factors for all reflections included in the refinement |
0.0777 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.007 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218373.html