Information card for entry 2218524
| Chemical name |
(4<i>R</i>,5<i>S</i>)-5-Benzyl-4-isopropyl-1,3,4-oxadiazinan-2-one |
| Formula |
C13 H18 N2 O2 |
| Calculated formula |
C13 H18 N2 O2 |
| SMILES |
O1C(=O)NN([C@H](C1)Cc1ccccc1)C(C)C |
| Title of publication |
(4<i>R</i>,5<i>S</i>)-5-Benzyl-4-isopropyl-1,3,4-oxadiazinan-2-one |
| Authors of publication |
Addison, Lacey D.; Dore, Delvis D.; Hitchcock, Shawn R.; Ferrence, Gregory M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
6 |
| Pages of publication |
o1040 - o1041 |
| a |
9.6423 ± 0.0014 Å |
| b |
11.4974 ± 0.0017 Å |
| c |
22.6 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2505.5 ± 0.6 Å3 |
| Cell temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for significantly intense reflections |
0.0597 |
| Weighted residual factors for all reflections included in the refinement |
0.1334 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.32 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218524.html