Information card for entry 2218589
| Chemical name |
(5<i>S</i>,6<i>S</i>)-4,5-Dimethyl-3-methylacryloyl-6-phenyl- 1,3,4-oxadiazinan-2-one |
| Formula |
C15 H18 N2 O3 |
| Calculated formula |
C15 H18 N2 O3 |
| SMILES |
C[C@@H]1N(C)N(C(=O)O[C@H]1c1ccccc1)C(=O)C(=C)C |
| Title of publication |
(5<i>S</i>,6<i>S</i>)-4,5-Dimethyl-3-methylacryloyl-6-phenyl-1,3,4-oxadiazinan-2-one |
| Authors of publication |
Knott, Stanley A.; Hitchcock, Shawn R.; Ferrence, Gregory M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
6 |
| Pages of publication |
o1101 |
| a |
8.7962 ± 0.0006 Å |
| b |
9.7797 ± 0.0006 Å |
| c |
16.6782 ± 0.0011 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1434.73 ± 0.16 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0348 |
| Residual factor for significantly intense reflections |
0.0318 |
| Weighted residual factors for significantly intense reflections |
0.0789 |
| Weighted residual factors for all reflections included in the refinement |
0.0803 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.067 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218589.html