Information card for entry 2218982
| Chemical name |
3-Methyl-2,6-dinitro-<i>N</i>-(3-pentyl)-4-[(2,3,4-tri-<i>O</i>- acetyl-β-D-xylosyl)aminomethyl]aniline |
| Formula |
C24 H34 N4 O11 |
| Calculated formula |
C24 H34 N4 O11 |
| SMILES |
N(C(CC)CC)c1c(N(=O)=O)c(c(cc1N(=O)=O)CN[C@H]1OC[C@H](OC(=O)C)[C@@H](OC(=O)C)[C@@H]1OC(=O)C)C |
| Title of publication |
3-Methyl-2,6-dinitro-<i>N</i>-(3-pentyl)-4-[(2,3,4-tri-<i>O</i>-acetyl-β-<small>D</small>-xylosyl)aminomethyl]aniline |
| Authors of publication |
Bai, Lifei; Wang, Xiaoming; Cai, Baochang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
8 |
| Pages of publication |
o1623 |
| a |
7.41 ± 0.0015 Å |
| b |
11.044 ± 0.002 Å |
| c |
34.106 ± 0.007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2791.1 ± 1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.111 |
| Residual factor for significantly intense reflections |
0.0674 |
| Weighted residual factors for significantly intense reflections |
0.1694 |
| Weighted residual factors for all reflections included in the refinement |
0.1962 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.042 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218982.html