Information card for entry 2219205
| Chemical name |
Diethyl {(4-methoxyphenyl)[5-(4-nitrophenyl)-1,3,4-thiadiazol-2- ylamino]methyl}phosphonate |
| Formula |
C20 H23 N4 O6 P S |
| Calculated formula |
C20 H23 N4 O6 P S |
| SMILES |
s1c(NC(P(=O)(OCC)OCC)c2ccc(OC)cc2)nnc1c1ccc(N(=O)=O)cc1 |
| Title of publication |
Diethyl {(4-methoxyphenyl)[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-ylamino]methyl}phosphonate |
| Authors of publication |
Yin, Li-He; Wan, Rong; Han, Feng; Wang, Bin; Wang, Jin-Tang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
8 |
| Pages of publication |
o1376 |
| a |
11.481 ± 0.002 Å |
| b |
19.426 ± 0.004 Å |
| c |
11.96 ± 0.002 Å |
| α |
90° |
| β |
117.08 ± 0.03° |
| γ |
90° |
| Cell volume |
2375 ± 1 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.124 |
| Residual factor for significantly intense reflections |
0.068 |
| Weighted residual factors for significantly intense reflections |
0.126 |
| Weighted residual factors for all reflections included in the refinement |
0.146 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219205.html