Information card for entry 2219273
| Chemical name |
Methyl 6-methoxycarbonylmethyl-2-oxo-4-phenyl-1,2,3,4-tetrahydropyrimidine- 5-carboxylate |
| Formula |
C15 H16 N2 O5 |
| Calculated formula |
C15 H16 N2 O5 |
| SMILES |
N1C(=O)NC(C(=C1CC(=O)OC)C(=O)OC)c1ccccc1 |
| Title of publication |
Methyl 6-methoxycarbonylmethyl-2-oxo-4-phenyl-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Authors of publication |
Kettmann, Viktor; Světlík, Jan; Veizerová, Lucia |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
9 |
| Pages of publication |
o1776 |
| a |
23.498 ± 0.005 Å |
| b |
12.072 ± 0.002 Å |
| c |
10.933 ± 0.005 Å |
| α |
90° |
| β |
99.15 ± 0.02° |
| γ |
90° |
| Cell volume |
3061.9 ± 1.6 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.1055 |
| Residual factor for significantly intense reflections |
0.0457 |
| Weighted residual factors for significantly intense reflections |
0.0985 |
| Weighted residual factors for all reflections included in the refinement |
0.1183 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.902 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219273.html