Information card for entry 2219304
| Chemical name |
Ethyl 4-{2,6-dichloro-4-[3-(2,6-difluorobenzoyl)ureido]phenoxy}butanoate |
| Formula |
C20 H18 Cl2 F2 N2 O5 |
| Calculated formula |
C20 H18 Cl2 F2 N2 O5 |
| SMILES |
Clc1c(OCCCC(=O)OCC)c(Cl)cc(NC(=O)NC(=O)c2c(F)cccc2F)c1 |
| Title of publication |
Ethyl 4-{2,6-dichloro-4-[3-(2,6-difluorobenzoyl)ureido]phenoxy}butanoate |
| Authors of publication |
Liu, Yin-Hong; Li, Fang-Shi; Li, Yi; Yu, Da-Sheng; Lu, Chui |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
9 |
| Pages of publication |
o1729 |
| a |
11.262 ± 0.002 Å |
| b |
10.463 ± 0.002 Å |
| c |
18.613 ± 0.004 Å |
| α |
90° |
| β |
98.78 ± 0.03° |
| γ |
90° |
| Cell volume |
2167.5 ± 0.8 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1333 |
| Residual factor for significantly intense reflections |
0.0818 |
| Weighted residual factors for significantly intense reflections |
0.2204 |
| Weighted residual factors for all reflections included in the refinement |
0.2896 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.133 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219304.html