Information card for entry 2219315
| Chemical name |
10-(4-Chlorophenyl)-9-(4-fluorophenyl)-3,3,6,6-tetramethyl-3,4,6,7,9,10- hexahydroacridine-1,8(2<i>H</i>,5<i>H</i>)-dione |
| Formula |
C29 H29 Cl F N O2 |
| Calculated formula |
C29 H29 Cl F N O2 |
| SMILES |
Clc1ccc(N2C3=C(C(C4=C2CC(CC4=O)(C)C)c2ccc(F)cc2)C(=O)CC(C3)(C)C)cc1 |
| Title of publication |
10-(4-Chlorophenyl)-9-(4-fluorophenyl)-3,3,6,6-tetramethyl-3,4,6,7,9,10-hexahydroacridine-1,8(2<i>H</i>,5<i>H</i>)-dione |
| Authors of publication |
Zhao, Ling-Ling; Teng, Da |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
9 |
| Pages of publication |
o1772 - o1773 |
| a |
12.0985 ± 0.0012 Å |
| b |
10.9001 ± 0.001 Å |
| c |
19.4724 ± 0.0018 Å |
| α |
90° |
| β |
101.231 ± 0.003° |
| γ |
90° |
| Cell volume |
2518.7 ± 0.4 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0631 |
| Residual factor for significantly intense reflections |
0.0549 |
| Weighted residual factors for significantly intense reflections |
0.1314 |
| Weighted residual factors for all reflections included in the refinement |
0.137 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.102 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219315.html