Information card for entry 2219487
| Chemical name |
(Imidazole-κ<i>N</i>^3^){<i>N</i>-[1-(2-oxidophenyl)ethylidene]-L-valinato- κ^3^O,N,O'}copper(II) |
| Formula |
C16 H19 Cu N3 O3 |
| Calculated formula |
C16 H19 Cu N3 O3 |
| SMILES |
[Cu]12(Oc3ccccc3C(=[N]1[C@H](C(=O)O2)C(C)C)C)[n]1c[nH]cc1 |
| Title of publication |
(Imidazole-κ<i>N</i>^3^){<i>N</i>-[1-(2-oxidophenyl)ethylidene]-<small>L</small>-valinato-κ^3^<i>O</i>,<i>N</i>,<i>O</i>'}copper(II) |
| Authors of publication |
Zhao, Gan-Qing; Liu, Qiao-Ru; Yang, Wei-Chun; Li, Song-Tian; Wang, Xiang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
10 |
| Pages of publication |
m1250 - m1251 |
| a |
12.2025 ± 0.0013 Å |
| b |
13.5248 ± 0.0014 Å |
| c |
19.791 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3266.2 ± 0.6 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0537 |
| Residual factor for significantly intense reflections |
0.0373 |
| Weighted residual factors for significantly intense reflections |
0.0784 |
| Weighted residual factors for all reflections included in the refinement |
0.0864 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.033 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219487.html