Information card for entry 2219707
| Chemical name |
1,4-Dibromo-2,5-bis(hexyloxy)benzene |
| Formula |
C18 H28 Br2 O2 |
| Calculated formula |
C18 H28 Br2 O2 |
| SMILES |
CCCCCCOc1cc(Br)c(cc1Br)OCCCCCC |
| Title of publication |
1,4-Dibromo-2,5-bis(hexyloxy)benzene |
| Authors of publication |
Li, Ying-Fei; Xu, Chen; Cen, Fei-Fei; Wang, Zhi-Qiang; Zhang, Yu-Qing |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
10 |
| Pages of publication |
o1930 |
| a |
6.9638 ± 0.0012 Å |
| b |
8.2581 ± 0.0014 Å |
| c |
9.7321 ± 0.0017 Å |
| α |
107.012 ± 0.002° |
| β |
106.981 ± 0.002° |
| γ |
99.193 ± 0.002° |
| Cell volume |
493.11 ± 0.15 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0326 |
| Residual factor for significantly intense reflections |
0.0252 |
| Weighted residual factors for significantly intense reflections |
0.0593 |
| Weighted residual factors for all reflections included in the refinement |
0.0632 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.061 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219707.html