Information card for entry 2219728
| Chemical name |
(<i>S</i>)-1,2-Dimethyl-1,1,2-triphenyl-2-(4-piperidiniomethyl)disilane chloride |
| Formula |
C26 H34 Cl N Si2 |
| Calculated formula |
C26 H34 Cl N Si2 |
| SMILES |
[Cl-].[Si@@]([Si](c1ccccc1)(C)c1ccccc1)(c1ccccc1)(C[NH+]1CCCCC1)C |
| Title of publication |
(<i>S</i>)-1,2-Dimethyl-1,1,2-triphenyl-2-(4-piperidiniomethyl)disilane chloride |
| Authors of publication |
Däschlein, Christian; Gessner, Viktoria H.; Strohmann, Carsten |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
10 |
| Pages of publication |
o1950 |
| a |
10.12 ± 0.002 Å |
| b |
13.289 ± 0.003 Å |
| c |
18.598 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2501.1 ± 0.9 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0566 |
| Residual factor for significantly intense reflections |
0.0551 |
| Weighted residual factors for significantly intense reflections |
0.1479 |
| Weighted residual factors for all reflections included in the refinement |
0.1491 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.051 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219728.html