Information card for entry 2219812
| Chemical name |
(<i>E</i>)-Methyl <i>N</i>'-(3,4,5-trimethoxybenzylidene)hydrazinecarboxylate |
| Formula |
C12 H16 N2 O5 |
| Calculated formula |
C12 H16 N2 O5 |
| SMILES |
C(=O)(OC)N/N=C/c1cc(c(c(c1)OC)OC)OC |
| Title of publication |
(<i>E</i>)-Methyl <i>N</i>'-(3,4,5-trimethoxybenzylidene)hydrazinecarboxylate |
| Authors of publication |
Lv, Lu-Ping; Xie, Jian-Wu; Yu, Wen-Bo; Li, Wei-Wei; Hu, Xian-Chao |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
11 |
| Pages of publication |
o2063 |
| a |
8.554 ± 0.003 Å |
| b |
22.705 ± 0.007 Å |
| c |
7.813 ± 0.002 Å |
| α |
90° |
| β |
116.15 ± 0.01° |
| γ |
90° |
| Cell volume |
1362.1 ± 0.7 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0651 |
| Residual factor for significantly intense reflections |
0.0441 |
| Weighted residual factors for significantly intense reflections |
0.1194 |
| Weighted residual factors for all reflections included in the refinement |
0.1325 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219812.html