Information card for entry 2220223
| Chemical name |
Methyl 5,7-dihydroxy-2,2,9-trimethyl-6,11-dioxo-6,11-dihydro-2H-anthra [2,3-b]pyran-8-carboxylate |
| Formula |
C22 H18 O7 |
| Calculated formula |
C22 H18 O7 |
| SMILES |
O1C(C=Cc2c(O)c3C(=O)c4c(O)c(c(cc4C(=O)c3cc12)C)C(=O)OC)(C)C |
| Title of publication |
Methyl 5,7-dihydroxy-2,2,9-trimethyl-6,11-dioxo-6,11-dihydro-2<i>H</i>-anthra[2,3-<i>b</i>]pyran-8-carboxylate |
| Authors of publication |
Noungoue Tchamo, Diderot; Brelot, Lydia; Antheaume, Cyril; Ngouela, Silvère; Lobstein, Annelise |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
12 |
| Pages of publication |
o2414 - o2415 |
| a |
6.9234 ± 0.0004 Å |
| b |
16.0765 ± 0.0009 Å |
| c |
17.5304 ± 0.0009 Å |
| α |
108.746 ± 0.002° |
| β |
98.725 ± 0.003° |
| γ |
94.147 ± 0.002° |
| Cell volume |
1810.97 ± 0.18 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1419 |
| Residual factor for significantly intense reflections |
0.0723 |
| Weighted residual factors for significantly intense reflections |
0.1416 |
| Weighted residual factors for all reflections included in the refinement |
0.1713 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.016 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220223.html