Information card for entry 2220455
| Chemical name |
1-Benzyl-4',5'-diphenylpiperidine-3-spiro-3'-pyrrolidine-2'-spiro-3''- indoline-4,2''-dione |
| Formula |
C34 H31 N3 O2 |
| Calculated formula |
C34 H31 N3 O2 |
| SMILES |
O=C1CCN(C[C@]21[C@H](c1ccccc1)[C@H](N[C@@]12C(=O)Nc2c1cccc2)c1ccccc1)Cc1ccccc1.O=C1CCN(C[C@@]21[C@@H](c1ccccc1)[C@@H](N[C@]12C(=O)Nc2c1cccc2)c1ccccc1)Cc1ccccc1 |
| Title of publication |
1-Benzyl-4',5'-diphenylpiperidine-3-spiro-3'-pyrrolidine-2'-spiro-3''-indoline-4,2''-dione |
| Authors of publication |
Suresh, J.; Kumar, R. Suresh; Rajapriya, A.; Perumal, S.; Lakshman, P. L. Nilantha |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
1 |
| Pages of publication |
o147 - o148 |
| a |
10.8575 ± 0.0003 Å |
| b |
13.7909 ± 0.0005 Å |
| c |
20.5053 ± 0.0009 Å |
| α |
89.767 ± 0.006° |
| β |
75.056 ± 0.004° |
| γ |
71.846 ± 0.003° |
| Cell volume |
2809.1 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1604 |
| Residual factor for significantly intense reflections |
0.0532 |
| Weighted residual factors for significantly intense reflections |
0.1149 |
| Weighted residual factors for all reflections included in the refinement |
0.1565 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.99 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220455.html
