Information card for entry 2220554
| Common name |
<i>N,N'</i>-Bis(5-chloro-2-hydroxybenzylidene)-2,2-dimethyl propane-1,3-diamine |
| Chemical name |
4,4'-Dichloro-2,2'-[2,2-dimethylpropane-1,3- diylbis(nitrilomethylidyne)]diphenol |
| Formula |
C19 H20 Cl2 N2 O2 |
| Calculated formula |
C19 H20 Cl2 N2 O2 |
| SMILES |
CC(C/N=C/c1cc(Cl)ccc1O)(C/N=C/c1cc(Cl)ccc1O)C |
| Title of publication |
4,4'-Dichloro-2,2'-[2,2-dimethylpropane-1,3-diylbis(nitrilomethylidyne)]diphenol |
| Authors of publication |
Yeap, Chin Sing; Kargar, Hadi; Kia, Reza; Fun, Hoong-Kun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
1 |
| Pages of publication |
o68 - o69 |
| a |
31.6843 ± 0.0008 Å |
| b |
6.2236 ± 0.0002 Å |
| c |
37.9015 ± 0.001 Å |
| α |
90° |
| β |
99.779 ± 0.001° |
| γ |
90° |
| Cell volume |
7365.2 ± 0.4 Å3 |
| Cell temperature |
100 ± 0.1 K |
| Ambient diffraction temperature |
100 ± 0.1 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0969 |
| Residual factor for significantly intense reflections |
0.0612 |
| Weighted residual factors for significantly intense reflections |
0.1046 |
| Weighted residual factors for all reflections included in the refinement |
0.1158 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.118 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220554.html