Information card for entry 2220589
| Chemical name |
Cyclohexylmethylammonium <i>N</i>,<i>N</i>'-dicyclohexyl-<i>N</i>,<i>N</i>'-dimethyl-<i>N</i>''- (2,2,2-trifluoroacetyl)phosphonic triamide) |
| Formula |
C23 H44 F3 N4 O2 P |
| Calculated formula |
C23 H44 F3 N4 O2 P |
| SMILES |
P([O-])(=NC(=O)C(F)(F)F)(N(C)C1CCCCC1)N(C)C1CCCCC1.[NH2+](C)C1CCCCC1 |
| Title of publication |
Cyclohexylmethylammonium <i>N</i>,<i>N</i>'-dicyclohexyl-<i>N</i>,<i>N</i>'-dimethyl-<i>N</i>''-(2,2,2-trifluoroacetyl)phosphonic triamide) |
| Authors of publication |
Yazdanbakhsh, Mohammad; Eshtiagh-Hosseini, Hossein; Sabbaghi, Fahimeh |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
1 |
| Pages of publication |
o78 |
| a |
9.183 ± 0.003 Å |
| b |
30.893 ± 0.007 Å |
| c |
9.241 ± 0.002 Å |
| α |
90° |
| β |
93.039 ± 0.007° |
| γ |
90° |
| Cell volume |
2617.9 ± 1.2 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1082 |
| Residual factor for significantly intense reflections |
0.0595 |
| Weighted residual factors for significantly intense reflections |
0.104 |
| Weighted residual factors for all reflections included in the refinement |
0.1129 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.08 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220589.html