Information card for entry 2220604
| Chemical name |
<i>N</i>,<i>N</i>,<i>N</i>',<i>N</i>'-Tetrakis(2-hydroxyethyl)terephthalamide |
| Formula |
C16 H24 N2 O6 |
| Calculated formula |
C16 H24 N2 O6 |
| SMILES |
OCCN(C(=O)c1ccc(cc1)C(=O)N(CCO)CCO)CCO |
| Title of publication |
<i>N</i>,<i>N</i>,<i>N</i>',<i>N</i>'-Tetrakis(2-hydroxyethyl)terephthalamide |
| Authors of publication |
Wang, Zhi-Qiang; Xu, Chen; Li, Ying-Fei; Cen, Fei-Fei; Zhang, Yu-Qing |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
1 |
| Pages of publication |
o166 |
| a |
10.3244 ± 0.0012 Å |
| b |
12.5378 ± 0.0014 Å |
| c |
12.8384 ± 0.0015 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1661.9 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.052 |
| Residual factor for significantly intense reflections |
0.0418 |
| Weighted residual factors for significantly intense reflections |
0.1163 |
| Weighted residual factors for all reflections included in the refinement |
0.1259 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.064 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220604.html