Information card for entry 2220618
| Chemical name |
N^2^,N^2'^-Bis(2-hydroxybenzylidene)-2,2'-bipyridyl-3,3'-dicarbohydrazide |
| Formula |
C26 H20 N6 O4 |
| Calculated formula |
C26 H20 N6 O4 |
| SMILES |
Oc1ccccc1C=NNC(=O)c1cccnc1c1ncccc1C(=O)NN=Cc1ccccc1O |
| Title of publication |
<i>N</i>^2^,<i>N</i>^2'^-Bis(2-hydroxybenzylidene)-2,2'-bipyridyl-3,3'-dicarbohydrazide |
| Authors of publication |
Miao, Shao-Bin; Zang, Lu-Lu; Fan, Ya-Wei; Ji, Bao-Ming |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
1 |
| Pages of publication |
o75 |
| a |
9.4251 ± 0.0013 Å |
| b |
11.7642 ± 0.0016 Å |
| c |
12.0384 ± 0.0016 Å |
| α |
98.842 ± 0.002° |
| β |
108.895 ± 0.002° |
| γ |
104.591 ± 0.002° |
| Cell volume |
1181.1 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0617 |
| Residual factor for significantly intense reflections |
0.041 |
| Weighted residual factors for significantly intense reflections |
0.0984 |
| Weighted residual factors for all reflections included in the refinement |
0.1108 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.02 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220618.html
