Information card for entry 2220662
| Chemical name |
<i>N</i>,<i>N</i>'-(2,2'-Dithiodi-o-phenylene)bis(furan-2-carboxamide) |
| Formula |
C22 H16 N2 O4 S2 |
| Calculated formula |
C22 H16 N2 O4 S2 |
| SMILES |
c1(ccccc1NC(=O)c1ccco1)SSc1c(cccc1)NC(=O)c1ccco1 |
| Title of publication |
<i>N</i>,<i>N</i>'-(2,2'-Dithiodi-<i>o</i>-phenylene)bis(furan-2-carboxamide) |
| Authors of publication |
Raftery, James; Lallbeeharry, Hiteyeshi; Bhowon, Minu G.; Laulloo, Sabina J.; Joule, John A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
1 |
| Pages of publication |
o16 |
| a |
9.6173 ± 0.0011 Å |
| b |
9.921 ± 0.0011 Å |
| c |
11.9906 ± 0.0014 Å |
| α |
109.77 ± 0.002° |
| β |
103.748 ± 0.002° |
| γ |
104.643 ± 0.002° |
| Cell volume |
973.84 ± 0.19 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.063 |
| Residual factor for significantly intense reflections |
0.0402 |
| Weighted residual factors for significantly intense reflections |
0.0712 |
| Weighted residual factors for all reflections included in the refinement |
0.0761 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.834 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220662.html