Information card for entry 2220667
| Common name |
<i>N,N</i>-Bis(3-methoxy-2-hydroxybenzylidene)-2,2-dimethyl propane-1,3-diamine |
| Chemical name |
6,6'-Dimethoxy-2,2'-[2,2-dimethylpropane-1,3- diylbis(nitrilomethylidyne)]diphenol |
| Formula |
C21 H26 N2 O4 |
| Calculated formula |
C21 H26 N2 O4 |
| SMILES |
COc1cccc(c1O)/C=N/CC(C/N=C/c1cccc(c1O)OC)(C)C |
| Title of publication |
6,6'-Dimethoxy-2,2'-[2,2-dimethylpropane-1,3-diylbis(nitrilomethylidyne)]diphenol |
| Authors of publication |
Yeap, Chin Sing; Kargar, Hadi; Kia, Reza; Fun, Hoong-Kun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
1 |
| Pages of publication |
o20 - o21 |
| a |
6.8859 ± 0.0003 Å |
| b |
30.809 ± 0.0014 Å |
| c |
18.8611 ± 0.0009 Å |
| α |
90° |
| β |
96.102 ± 0.003° |
| γ |
90° |
| Cell volume |
3978.7 ± 0.3 Å3 |
| Cell temperature |
100 ± 0.1 K |
| Ambient diffraction temperature |
100 ± 0.1 K |
| Number of distinct elements |
4 |
| Space group number |
9 |
| Hermann-Mauguin space group symbol |
C 1 c 1 |
| Hall space group symbol |
C -2yc |
| Residual factor for all reflections |
0.0767 |
| Residual factor for significantly intense reflections |
0.0704 |
| Weighted residual factors for significantly intense reflections |
0.1972 |
| Weighted residual factors for all reflections included in the refinement |
0.2018 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.069 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220667.html