Information card for entry 2220744
| Chemical name |
3-(2,6-Dioxopiperidin-3-yl)-3-azabicyclo[3.2.0]heptane-2,4-dione |
| Formula |
C11 H12 N2 O4 |
| Calculated formula |
C11 H12 N2 O4 |
| SMILES |
O=C1N(C(=O)[C@H]2[C@@H]1CC2)[C@H]1C(=O)NC(=O)CC1.O=C1N(C(=O)[C@@H]2[C@H]1CC2)[C@@H]1C(=O)NC(=O)CC1 |
| Title of publication |
3-(2,6-Dioxopiperidin-3-yl)-3-azabicyclo[3.2.0]heptane-2,4-dione |
| Authors of publication |
Hijji, Yousef M.; Benjamin, Ellis; Benjamin, Earl; Butcher, Ray J.; Jasinski, Jerry P. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
2 |
| Pages of publication |
o394 - o395 |
| a |
10.7332 ± 0.0007 Å |
| b |
9.9358 ± 0.0005 Å |
| c |
11.0753 ± 0.0007 Å |
| α |
90° |
| β |
116.201 ± 0.008° |
| γ |
90° |
| Cell volume |
1059.74 ± 0.13 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/a 1 |
| Hall space group symbol |
-P 2yab |
| Residual factor for all reflections |
0.0617 |
| Residual factor for significantly intense reflections |
0.0386 |
| Weighted residual factors for significantly intense reflections |
0.0981 |
| Weighted residual factors for all reflections included in the refinement |
0.1075 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.99 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220744.html