Information card for entry 2220765
| Chemical name |
<i>trans</i>-{1,8-Bis[(<i>R</i>)-α-methylbenzyl]-1,3,6,8,10,13- hexaazacyclotetradecane}dithiocyanatonickel(II) |
| Formula |
C26 H38 N8 Ni S2 |
| Calculated formula |
C26 H38 N8 Ni S2 |
| SMILES |
[Ni]123([NH]4CN(C[NH]3CC[NH]2CN(C[NH]1CC4)[C@@H](c1ccccc1)C)[C@@H](c1ccccc1)C)(N=C=S)N=C=S |
| Title of publication |
<i>trans</i>-{1,8-Bis[(<i>R</i>)-α-methylbenzyl]-1,3,6,8,10,13-hexaazacyclotetradecane}dithiocyanatonickel(II) |
| Authors of publication |
Shin, Jong Won; Min, Kil Sik |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
2 |
| Pages of publication |
m234 |
| a |
8.5313 ± 0.0005 Å |
| b |
15.3141 ± 0.001 Å |
| c |
44.004 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
5749.1 ± 0.6 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.1332 |
| Residual factor for significantly intense reflections |
0.0571 |
| Weighted residual factors for significantly intense reflections |
0.1088 |
| Weighted residual factors for all reflections included in the refinement |
0.1491 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.037 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220765.html