Information card for entry 2220830
| Chemical name |
5-(2-Methoxybenzyl)-4-(2-methoxyphenyl)-4<i>H</i>-1,2,4-triazol-3-ol |
| Formula |
C17 H17 N3 O3 |
| Calculated formula |
C17 H17 N3 O3 |
| SMILES |
O=C1N(C(=NN1)Cc1c(OC)cccc1)c1c(OC)cccc1 |
| Title of publication |
5-(2-Methoxybenzyl)-4-(2-methoxyphenyl)-4<i>H</i>-1,2,4-triazol-3-ol |
| Authors of publication |
Hanif, Muhammad; Qadeer, Ghulam; Rama, Nasim Hasan; Akhtar, Javeed; Helliwell, Madeleine |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
2 |
| Pages of publication |
o329 |
| a |
7.4941 ± 0.0012 Å |
| b |
8.373 ± 0.0013 Å |
| c |
24.77 ± 0.004 Å |
| α |
90° |
| β |
97.455 ± 0.002° |
| γ |
90° |
| Cell volume |
1541.1 ± 0.4 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0408 |
| Residual factor for significantly intense reflections |
0.0366 |
| Weighted residual factors for significantly intense reflections |
0.0891 |
| Weighted residual factors for all reflections included in the refinement |
0.0914 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.055 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220830.html