Information card for entry 2220980
| Common name |
Salvinoric Acid |
| Chemical name |
(2<i>S</i>,4a<i>R</i>,6a<i>R</i>,7<i>R</i>,9<i>S</i>,10a<i>S</i>,10b<i>R</i>)- 7-Carboxy-2-(3-furyl)-6a,10b-dimethyl-4,10- dioxoperhydrobenzo[<i>f</i>]isochromen-9-yl acetate |
| Formula |
C22 H26 O8 |
| Calculated formula |
C22 H26 O8 |
| SMILES |
CC(=O)O[C@H]1C[C@@H](C(=O)O)[C@]2([C@H](C1=O)[C@@]1(C)C[C@H](OC(=O)[C@@H]1CC2)c1cocc1)C |
| Title of publication |
(2<i>S</i>,4a<i>R</i>,6a<i>R</i>,7<i>R</i>,9<i>S</i>,10a<i>S</i>,10b<i>R</i>)-7-Carboxy-2-(3-furyl)-6a,10b-dimethyl-4,10-dioxoperhydrobenzo[<i>f</i>]isochromen-9-yl acetate |
| Authors of publication |
Carvalho, Paulo; Kutrzeba, Lukasz M.; Zjawiony, Jordan K.; Avery, Mitchell A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
3 |
| Pages of publication |
o471 - o472 |
| a |
11.2735 ± 0.0006 Å |
| b |
16.8015 ± 0.0009 Å |
| c |
11.3765 ± 0.0006 Å |
| α |
90° |
| β |
111.934 ± 0.003° |
| γ |
90° |
| Cell volume |
1998.86 ± 0.19 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0319 |
| Residual factor for significantly intense reflections |
0.0285 |
| Weighted residual factors for significantly intense reflections |
0.0662 |
| Weighted residual factors for all reflections included in the refinement |
0.0741 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.1 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220980.html