Information card for entry 2221055
| Common name |
3-[4-(3,4-dihydro-2<i>H</i>-1,3-benzoxazin-3-yl)phenyl]-3,4-dihydro-2<i>H</i>- 1,3-benzoxazine |
| Chemical name |
3,3'-(<i>p</i>-Phenylene)bis(3,4-dihydro-2<i>H</i>-1,3-benzoxazine) |
| Formula |
C22 H20 N2 O2 |
| Calculated formula |
C22 H20 N2 O2 |
| SMILES |
c1ccc2c(c1)CN(CO2)c1ccc(cc1)N1COc2c(C1)cccc2 |
| Title of publication |
3,3'-(<i>p</i>-Phenylene)bis(3,4-dihydro-2<i>H</i>-1,3-benzoxazine) |
| Authors of publication |
Ranjith, Sekaran; Thenmozhi, Sundar; Manikannan, Ramaiyan; Muthusubramanian, Shanmugam; Subbiahpandi, Arunachalathevar |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
3 |
| Pages of publication |
o581 |
| a |
9.191 ± 0.005 Å |
| b |
8.794 ± 0.004 Å |
| c |
11.317 ± 0.005 Å |
| α |
90° |
| β |
113.9 ± 0.03° |
| γ |
90° |
| Cell volume |
836.3 ± 0.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0688 |
| Residual factor for significantly intense reflections |
0.0501 |
| Weighted residual factors for significantly intense reflections |
0.1443 |
| Weighted residual factors for all reflections included in the refinement |
0.1639 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.024 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221055.html