Information card for entry 2221126
| Chemical name |
<i>rac</i>-(2<i>R*</i>,3<i>S</i>*,5<i>S*</i>,6<i>R*</i>,7<i>S*</i>, 8<i>S</i>*)-7,8-Dichlorobicyclo[2.2.2]octane-2,3,5,6-tetrayl tetraacetate |
| Formula |
C16 H20 Cl2 O8 |
| Calculated formula |
C16 H20 Cl2 O8 |
| SMILES |
O([C@@H]1[C@H](OC(=O)C)C2[C@@H]([C@H](C1[C@H](OC(=O)C)[C@@H]2OC(=O)C)Cl)Cl)C(=O)C.O([C@H]1[C@@H](OC(=O)C)C2[C@H]([C@@H](C1[C@@H](OC(=O)C)[C@H]2OC(=O)C)Cl)Cl)C(=O)C |
| Title of publication |
<i>rac</i>-(2<i>R*</i>,3<i>S</i>*,5<i>S*</i>,6<i>R*</i>,7<i>S*</i>,8<i>S</i>*)-7,8-Dichlorobicyclo[2.2.2]octane-2,3,5,6-tetrayl tetraacetate |
| Authors of publication |
Şahin, Ertan; Baran, Arif; Balcı, Metin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
3 |
| Pages of publication |
o526 - o527 |
| a |
10.1061 ± 0.0003 Å |
| b |
13.3383 ± 0.0004 Å |
| c |
14.2229 ± 0.0003 Å |
| α |
90° |
| β |
90.189 ± 0.002° |
| γ |
90° |
| Cell volume |
1917.21 ± 0.09 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/a 1 |
| Hall space group symbol |
-P 2yab |
| Residual factor for all reflections |
0.0654 |
| Residual factor for significantly intense reflections |
0.0647 |
| Weighted residual factors for all reflections included in the refinement |
0.1571 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.322 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221126.html