Information card for entry 2221383
| Chemical name |
(4<i>S</i>,5<i>S</i>)-2-(2-Thienyl)-1,3-dioxolane-4,5-dicarboxamide |
| Formula |
C9 H10 N2 O4 S |
| Calculated formula |
C9 H10 N2 O4 S |
| SMILES |
s1cccc1C1O[C@@H]([C@H](O1)C(=O)N)C(=O)N |
| Title of publication |
(4<i>S</i>,5<i>S</i>)-2-(2-Thienyl)-1,3-dioxolane-4,5-dicarboxamide |
| Authors of publication |
Xu, Wei; Yang, Zheng; Li, Xin-Hua; Liu, Bo-Nian; Wang, De-Cai |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
4 |
| Pages of publication |
o764 |
| a |
8.925 ± 0.0018 Å |
| b |
4.796 ± 0.001 Å |
| c |
12.109 ± 0.002 Å |
| α |
90° |
| β |
90.6 ± 0.03° |
| γ |
90° |
| Cell volume |
518.29 ± 0.17 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0458 |
| Residual factor for significantly intense reflections |
0.0397 |
| Weighted residual factors for significantly intense reflections |
0.1172 |
| Weighted residual factors for all reflections included in the refinement |
0.1235 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.008 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221383.html