Information card for entry 2221575
| Chemical name |
1,4a,7-trimethyl-7-vinyl-1,2,3,4,4a,4b,5,6,7,9,10,10a- dodecahydrophenanthrene-1-carboxylic acid |
| Formula |
C20 H30 O2 |
| Calculated formula |
C20 H30 O2 |
| SMILES |
O=C(O)[C@]1([C@@H]2CCC3=C[C@@](C=C)(C)CC[C@@H]3[C@]2(CCC1)C)C |
| Title of publication |
1,4a,7-Trimethyl-7-vinyl-1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydrophenanthrene-1-carboxylic acid |
| Authors of publication |
Chen, Yu-xiang; Zhao, Zhen-dong; Gu, Yan; Wang, Yu-min |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
5 |
| Pages of publication |
o1117 |
| a |
20.818 ± 0.004 Å |
| b |
10.99 ± 0.002 Å |
| c |
7.765 ± 0.0016 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1776.6 ± 0.6 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
18 |
| Hermann-Mauguin space group symbol |
P 21 21 2 |
| Hall space group symbol |
P 2 2ab |
| Residual factor for all reflections |
0.1016 |
| Residual factor for significantly intense reflections |
0.0651 |
| Weighted residual factors for significantly intense reflections |
0.1621 |
| Weighted residual factors for all reflections included in the refinement |
0.1875 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221575.html