Information card for entry 2221651
| Chemical name |
1-[4-(Difluoromethoxy)phenyl]-<i>N</i>-(2,3-dimethylphenyl)-1<i>H</i>-1,2,4- triazole-3-carboxamide |
| Formula |
C18 H16 F2 N4 O2 |
| Calculated formula |
C18 H16 F2 N4 O2 |
| SMILES |
FC(F)Oc1ccc(n2nc(nc2)C(=O)Nc2cccc(c2C)C)cc1 |
| Title of publication |
1-[4-(Difluoromethoxy)phenyl]-<i>N</i>-(2,3-dimethylphenyl)-1<i>H</i>-1,2,4-triazole-3-carboxamide |
| Authors of publication |
Wang, Yu-Guang; Huang, Guo-Bo; Zhu, Bing-Chun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
5 |
| Pages of publication |
o1015 - o1016 |
| a |
7.5543 ± 0.001 Å |
| b |
7.8132 ± 0.001 Å |
| c |
14.819 ± 0.0019 Å |
| α |
95.974 ± 0.002° |
| β |
98.593 ± 0.001° |
| γ |
101.523 ± 0.001° |
| Cell volume |
839.28 ± 0.19 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0572 |
| Residual factor for significantly intense reflections |
0.0423 |
| Weighted residual factors for significantly intense reflections |
0.1114 |
| Weighted residual factors for all reflections included in the refinement |
0.1234 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.059 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221651.html