Information card for entry 2221673
| Chemical name |
Aqua(3-formyl-2-oxidobenzoato-κ^2^<i>O</i>^1^,<i>O</i>^2^)(1,10- phenanthroline-κ^2^<i>N</i>,<i>N</i>')copper(II) dimethylformamide solvate |
| Formula |
C23 H21 Cu N3 O6 |
| Calculated formula |
C23 H21 Cu N3 O6 |
| SMILES |
[Cu]12([n]3cccc4ccc5ccc[n]1c5c34)([OH2])Oc1c(C=O)cccc1C(=O)O2.CN(C)C=O |
| Title of publication |
Aqua(3-formyl-2-oxidobenzoato-κ^2^<i>O</i>^1^,<i>O</i>^2^)(1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')copper(II) dimethylformamide solvate |
| Authors of publication |
Yu, Zhao-Wen; Chang, Ling; Song, Peng; He, Min-Hui |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
5 |
| Pages of publication |
m485 |
| a |
9.6936 ± 0.0006 Å |
| b |
10.902 ± 0.0012 Å |
| c |
11.28 ± 0.0007 Å |
| α |
103.834 ± 0.001° |
| β |
109.764 ± 0.001° |
| γ |
98.604 ± 0.001° |
| Cell volume |
1054.09 ± 0.15 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.038 |
| Residual factor for significantly intense reflections |
0.036 |
| Weighted residual factors for significantly intense reflections |
0.1108 |
| Weighted residual factors for all reflections included in the refinement |
0.1122 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.08 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221673.html