Information card for entry 2221747
| Chemical name |
3,3',5,5'-Tetrabromo-2,2'-bithiophene |
| Formula |
C8 H2 Br4 S2 |
| Calculated formula |
C8 H2 Br4 S2 |
| SMILES |
Brc1cc(sc1c1sc(cc1Br)Br)Br |
| Title of publication |
3,3',5,5'-Tetrabromo-2,2'-bithiophene |
| Authors of publication |
Li, Hongqi; Li, Lin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
5 |
| Pages of publication |
o952 |
| a |
17.164 ± 0.003 Å |
| b |
4.0153 ± 0.0007 Å |
| c |
18.655 ± 0.003 Å |
| α |
90° |
| β |
115.395 ± 0.003° |
| γ |
90° |
| Cell volume |
1161.4 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0852 |
| Residual factor for significantly intense reflections |
0.0784 |
| Weighted residual factors for significantly intense reflections |
0.2014 |
| Weighted residual factors for all reflections included in the refinement |
0.2083 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.996 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221747.html