Information card for entry 2221749
| Chemical name |
{6,6'-Diethoxy-2,2'-[2,2-dimethylpropane-1,3-diylbis(nitrilomethylidyne)]diphenolato}copper(II) monohydrate |
| Formula |
C23 H30 Cu N2 O5 |
| Calculated formula |
C23 H30 Cu N2 O5 |
| SMILES |
[Cu]123Oc4c(OCC)cccc4C=[N]2CC(C[N]3=Cc2cccc(OCC)c2O1)(C)C.O |
| Title of publication |
{6,6'-Diethoxy-2,2'-[2,2-dimethylpropane-1,3-diylbis(nitrilomethylidyne)]diphenolato}copper(II) monohydrate |
| Authors of publication |
Kargar, Hadi; Kia, Reza; Fun, Hoong-Kun; Jamshidvand, Arezoo |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
5 |
| Pages of publication |
m515 - m516 |
| a |
9.427 ± 0.003 Å |
| b |
10.805 ± 0.003 Å |
| c |
12.771 ± 0.004 Å |
| α |
114.554 ± 0.013° |
| β |
99.479 ± 0.014° |
| γ |
102.676 ± 0.014° |
| Cell volume |
1105.3 ± 0.6 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.035 |
| Residual factor for significantly intense reflections |
0.029 |
| Weighted residual factors for significantly intense reflections |
0.0737 |
| Weighted residual factors for all reflections included in the refinement |
0.0771 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.054 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221749.html