Information card for entry 2221757
| Chemical name |
<i>catena</i>-Poly[[aquanickel(II)]-μ-pyridine-2,6- dicarboxylato-[aquanickel(II)]-μ-2,5-di-4-pyridyl-1,3,4-thiadiazole] |
| Formula |
C26 H18 N6 Ni2 O10 S |
| Calculated formula |
C26 H18 N6 Ni2 O10 S |
| SMILES |
C1(=O)O[Ni]2([n]3c1cccc3C(=O)O2)([n]1ccc(cc1)c1nnc(s1)c1cc[n](cc1)[Ni]12[n]3c(C(=O)O1)cccc3C(=O)O2)[OH2].O |
| Title of publication |
<i>catena</i>-Poly[[aquanickel(II)]-μ-pyridine-2,6-dicarboxylato-[aquanickel(II)]-μ-2,5-di-4-pyridyl-1,3,4-thiadiazole] |
| Authors of publication |
Zhang, Xin-Yan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
5 |
| Pages of publication |
m497 |
| a |
8.2998 ± 0.0012 Å |
| b |
10.0819 ± 0.0015 Å |
| c |
17.318 ± 0.003 Å |
| α |
96.652 ± 0.002° |
| β |
100.629 ± 0.002° |
| γ |
108.077 ± 0.002° |
| Cell volume |
1330.5 ± 0.4 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0767 |
| Residual factor for significantly intense reflections |
0.0463 |
| Weighted residual factors for significantly intense reflections |
0.1248 |
| Weighted residual factors for all reflections included in the refinement |
0.147 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.965 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221757.html