Information card for entry 2221764
| Chemical name |
1-(2-Fluorobenzylideneamino)pyridinium bis(1,2-dicyanoethene-1,2-dithiolato)nickelate(II) |
| Formula |
C32 H20 F2 N8 Ni S4 |
| Calculated formula |
C32 H20 F2 N8 Ni S4 |
| SMILES |
C1(=C(C#N)S[Ni]2(S1)SC(=C(C#N)S2)C#N)C#N.Fc1ccccc1/C=N/[n+]1ccccc1.Fc1ccccc1/C=N/[n+]1ccccc1 |
| Title of publication |
1-(2-Fluorobenzylideneamino)pyridinium bis(1,2-dicyanoethene-1,2-dithiolato)nickelate(II) |
| Authors of publication |
Zhang, Hui; Zhou, Quan; Hu, Fengkai; Xu, Han; Chang, Guanru |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
5 |
| Pages of publication |
m599 |
| a |
7.9248 ± 0.0013 Å |
| b |
9.1774 ± 0.0015 Å |
| c |
11.1526 ± 0.0018 Å |
| α |
88.326 ± 0.003° |
| β |
77.202 ± 0.004° |
| γ |
85.448 ± 0.004° |
| Cell volume |
788.4 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0887 |
| Residual factor for significantly intense reflections |
0.0521 |
| Weighted residual factors for significantly intense reflections |
0.0828 |
| Weighted residual factors for all reflections included in the refinement |
0.0943 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.757 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221764.html