Information card for entry 2221779
| Chemical name |
1-Acryloyl-2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-4-one |
| Formula |
C22 H21 Cl2 N O2 |
| Calculated formula |
C22 H21 Cl2 N O2 |
| SMILES |
Clc1ccc([C@@H]2N([C@@H]([C@H](C(=O)[C@H]2C)C)c2ccc(Cl)cc2)C(=O)C=C)cc1.Clc1ccc([C@H]2N([C@H]([C@@H](C(=O)[C@@H]2C)C)c2ccc(Cl)cc2)C(=O)C=C)cc1 |
| Title of publication |
1-Acryloyl-2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-4-one |
| Authors of publication |
Lakshminarayana, B. N.; Shashidhara Prasad, J.; Gnanendra, C. R.; Sridhar, M. A.; Naik, Nagaraja |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
5 |
| Pages of publication |
o1001 |
| a |
10.241 ± 0.0008 Å |
| b |
19.507 ± 0.0011 Å |
| c |
10.976 ± 0.0009 Å |
| α |
90° |
| β |
112.567 ± 0.002° |
| γ |
90° |
| Cell volume |
2024.8 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0584 |
| Residual factor for significantly intense reflections |
0.044 |
| Weighted residual factors for significantly intense reflections |
0.1045 |
| Weighted residual factors for all reflections included in the refinement |
0.1132 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.033 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221779.html