Information card for entry 2221787
| Chemical name |
2-Methyl-1,2,3,4-tetrahydroisoquinolin-6-yl <i>N</i>-phenylcarbamate |
| Formula |
C17 H18 N2 O2 |
| Calculated formula |
C17 H18 N2 O2 |
| SMILES |
N(C(=O)Oc1ccc2c(c1)CCN(C2)C)c1ccccc1 |
| Title of publication |
2-Methyl-1,2,3,4-tetrahydroisoquinolin-6-yl <i>N</i>-phenylcarbamate |
| Authors of publication |
Zhang, Qi-Hong; Xie, Qiong; Wang, Jing-Mei; Qiu, Zhui-Bai |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
5 |
| Pages of publication |
o1058 |
| a |
6.0653 ± 0.0006 Å |
| b |
15.554 ± 0.0017 Å |
| c |
15.1817 ± 0.0016 Å |
| α |
90° |
| β |
93.488 ± 0.002° |
| γ |
90° |
| Cell volume |
1429.6 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.054 |
| Residual factor for significantly intense reflections |
0.0456 |
| Weighted residual factors for significantly intense reflections |
0.1221 |
| Weighted residual factors for all reflections included in the refinement |
0.1283 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.015 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221787.html