Information card for entry 2221949
| Chemical name |
5-Hydroxy-1,7-bis(1<i>H</i>-indol-3-yl)hepta-1,4,6-trien-3-one hemihydrate |
| Formula |
C23 H19 N2 O2.5 |
| Calculated formula |
C23 H19 N2 O2.5 |
| SMILES |
OC(=C\C(=O)/C=C/c1c2ccccc2[nH]c1)/C=C/c1c2c([nH]c1)cccc2.O |
| Title of publication |
5-Hydroxy-1,7-bis(1<i>H</i>-indol-3-yl)hepta-1,4,6-trien-3-one hemihydrate |
| Authors of publication |
Li, Jun-Hai; Sun, Gang-Chun; Mague, Joel T.; Xie, Jing-Xi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
6 |
| Pages of publication |
o1409 |
| a |
5.5285 ± 0.0007 Å |
| b |
22.916 ± 0.003 Å |
| c |
28.194 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3571.9 ± 0.8 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0375 |
| Residual factor for significantly intense reflections |
0.0326 |
| Weighted residual factors for significantly intense reflections |
0.0809 |
| Weighted residual factors for all reflections included in the refinement |
0.0843 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.058 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221949.html