Information card for entry 2221969
| Chemical name |
Ethyl 4-[3,5-bis(trifluoromethyl)phenyl]-6-methyl-2-oxo-1,2,3,4- tetrahydropyrimidine-5-carboxylate |
| Formula |
C16 H14 F6 N2 O3 |
| Calculated formula |
C16 H14 F6 N2 O3 |
| SMILES |
FC(F)(F)c1cc(cc(c1)C(F)(F)F)C1NC(=O)NC(=C1C(=O)OCC)C |
| Title of publication |
Ethyl 4-[3,5-bis(trifluoromethyl)phenyl]-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Authors of publication |
Fun, Hoong-Kun; Quah, Ching Kheng; Babu, M.; Kalluraya, B. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
6 |
| Pages of publication |
o1404 - o1405 |
| a |
12.6876 ± 0.0002 Å |
| b |
7.3073 ± 0.0001 Å |
| c |
19.9547 ± 0.0003 Å |
| α |
90° |
| β |
114.443 ± 0.001° |
| γ |
90° |
| Cell volume |
1684.23 ± 0.05 Å3 |
| Cell temperature |
110 ± 0.1 K |
| Ambient diffraction temperature |
110 ± 0.1 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0603 |
| Residual factor for significantly intense reflections |
0.0463 |
| Weighted residual factors for significantly intense reflections |
0.1246 |
| Weighted residual factors for all reflections included in the refinement |
0.1339 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.041 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221969.html