Information card for entry 2221971
| Chemical name |
r-2,c-6-Bis(4-methoxyphenyl)-c-3,t-3-dimethyl-1-nitrosopiperidin-4-one |
| Formula |
C21 H24 N2 O4 |
| Calculated formula |
C21 H24 N2 O4 |
| SMILES |
N1([C@H](C(C(=O)C[C@H]1c1ccc(cc1)OC)(C)C)c1ccc(cc1)OC)N=O |
| Title of publication |
<i>r</i>-2,<i>c</i>-6-Bis(4-methoxyphenyl)-<i>c</i>-3,<i>t</i>-3-dimethyl-1-nitrosopiperidin-4-one |
| Authors of publication |
Kavitha, T.; Ponnuswamy, S.; Sakthivel, P.; Karthik, K.; Ponnuswamy, M. N. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
6 |
| Pages of publication |
o1420 |
| a |
7.254 ± 0.0003 Å |
| b |
15.0469 ± 0.0006 Å |
| c |
17.0741 ± 0.0007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1863.64 ± 0.13 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0527 |
| Residual factor for significantly intense reflections |
0.0386 |
| Weighted residual factors for significantly intense reflections |
0.0974 |
| Weighted residual factors for all reflections included in the refinement |
0.1088 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.025 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221971.html