Information card for entry 2222028
| Chemical name |
2-Phenyl-1<i>H</i>-1,3,7,8-tetraazacyclopenta[<i>l</i>]phenanthrene |
| Formula |
C19 H12 N4 |
| Calculated formula |
C19 H12 N4 |
| SMILES |
c1ccc2c3c(c4cccnc4c2n1)nc(c1ccccc1)[nH]3 |
| Title of publication |
2-Phenyl-1<i>H</i>-1,3,7,8-tetraazacyclopenta[<i>l</i>]phenanthrene |
| Authors of publication |
Liu, Dong-Ming; Li, Xiu-Ying; Wang, Xiang-Cheng; Li, Chun-Xiang; Liu, Chun-Bo |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
6 |
| Pages of publication |
o1308 |
| a |
10.016 ± 0.002 Å |
| b |
12.21 ± 0.002 Å |
| c |
12.415 ± 0.003 Å |
| α |
89.9 ± 0.03° |
| β |
78.44 ± 0.03° |
| γ |
77.96 ± 0.03° |
| Cell volume |
1453.5 ± 0.6 Å3 |
| Cell temperature |
292 ± 2 K |
| Ambient diffraction temperature |
292 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1191 |
| Residual factor for significantly intense reflections |
0.0586 |
| Weighted residual factors for significantly intense reflections |
0.1327 |
| Weighted residual factors for all reflections included in the refinement |
0.1562 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.012 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222028.html